РУАЭСТ (RUAEST)
A new copper(II) complex of 1,10-phenanthroline (C12H8N2) and the meta-aminobenzoate ion (m-amb; C H NO), having the formula Cu(C12H8N2)(C7H6NO2)Cl$0.5H2O, is prepared and 7 6 2 characterized by elemental analysis, IR spectroscopy, and single crystal X-ray diffraction. The structure is built up from monomeric units in which the coordination environment around the metal ion is a square plane arising from a bidentate 1,10-phenanthroline molecule, a monodentate m-amb anion, and a chloride ion. A very long (Cu—N = 2.856(5) Е) bond to the nitrogen atom of an adjacent m-amb ion generates [101] polymeric chains in the crystal. The crystal structure is consolidated by N—HᄷO and O—HᄷO hydrogen bonds and C—HᄷO, C—HᄷCl, and aromatic $—$ stacking interactions. Crystal data: C19H15ClCuN3O2.5, Mr = 424.33, monoclinic, P21/n (No. 14), a = 9.8200(5), b = 10.9291(7), c = 16.3803(9) Е, $ = 105.293(3)$, V = 1695.74(17) Е3, Z = 4, R(F) = 0.043, wR(F 2) = 0.122.